C20H29N3O5S — CID 171775340
tert-butyl N-[(3R)-5-oxo-1-(4-piperidin-4-ylsulfonylphenyl)pyrrolidin-3-yl]carbamate (PubChem CID 171775340) has the molecular formula C20H29N3O5S and a molecular weight of 423.54 g/mol. Its IUPAC name is tert-butyl N-[(3R)-5-oxo-1-(4-piperidin-4-ylsulfonylphenyl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-5-oxo-1-(4-piperidin-4-ylsulfonylphenyl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 171775340 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | tert-butyl N-[(3R)-5-oxo-1-(4-piperidin-4-ylsulfonylphenyl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CC(=O)N(c2ccc(S(=O)(=O)C3CCNCC3)cc2)C1 |
| InChI | InChI=1S/C20H29N3O5S/c1-20(2,3)28-19(25)22-14-12-18(24)23(13-14)15-4-6-16(7-5-15)29(26,27)17-8-10-21-11-9-17/h4-7,14,17,21H,8-13H2,1-3H3,(H,22,25)/t14-/m1/s1 |
| InChIKey | YICRSSAMELALRY-CQSZACIVSA-N |
| XLogP | 1.84 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |