C23H31ClN4O — CID 165176811
5-chloro-3-[3-[6-(3-piperazin-1-ylpropoxy)-2H-pyridin-1-yl]propyl]-1H-indole (PubChem CID 165176811) has the molecular formula C23H31ClN4O and a molecular weight of 414.98 g/mol. Its IUPAC name is 5-chloro-3-[3-[6-(3-piperazin-1-ylpropoxy)-2H-pyridin-1-yl]propyl]-1H-indole.
| Compound Name | 5-chloro-3-[3-[6-(3-piperazin-1-ylpropoxy)-2H-pyridin-1-yl]propyl]-1H-indole |
|---|---|
| PubChem CID | 165176811 |
| Molecular Formula | C23H31ClN4O |
| Molecular Weight | 414.98 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 5-chloro-3-[3-[6-(3-piperazin-1-ylpropoxy)-2H-pyridin-1-yl]propyl]-1H-indole |
| SMILES | Clc1ccc2[nH]cc(CCCN3CC=CC=C3OCCCN3CCNCC3)c2c1 |
| InChI | InChI=1S/C23H31ClN4O/c24-20-7-8-22-21(17-20)19(18-26-22)5-3-13-28-12-2-1-6-23(28)29-16-4-11-27-14-9-25-10-15-27/h1-2,6-8,17-18,25-26H,3-5,9-16H2 |
| InChIKey | LTTXPHXWEYIYOB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 43.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.98 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|