C14H9F6N3O2 — CID 165177301
[(E)-[4-(trifluoromethyl)phenyl]methylideneamino] 1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylate (PubChem CID 165177301) has the molecular formula C14H9F6N3O2 and a molecular weight of 365.23 g/mol. Its IUPAC name is [(E)-[4-(trifluoromethyl)phenyl]methylideneamino] 1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylate.
| Compound Name | [(E)-[4-(trifluoromethyl)phenyl]methylideneamino] 1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 165177301 |
| Molecular Formula | C14H9F6N3O2 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | [(E)-[4-(trifluoromethyl)phenyl]methylideneamino] 1-methyl-3-(trifluoromethyl)pyrazole-4-carboxylate |
| SMILES | Cn1cc(C(=O)O/N=C/c2ccc(C(F)(F)F)cc2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H9F6N3O2/c1-23-7-10(11(22-23)14(18,19)20)12(24)25-21-6-8-2-4-9(5-3-8)13(15,16)17/h2-7H,1H3/b21-6+ |
| InChIKey | YSURHIASQOESOQ-AERZKKPOSA-N |
| XLogP | 3.65 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|