C20H16FN5O — CID 165177918
5-(3-cyanoanilino)-2-(3-fluoro-5-methylanilino)pyridine-3-carboxamide (PubChem CID 165177918) has the molecular formula C20H16FN5O and a molecular weight of 361.38 g/mol. Its IUPAC name is 5-(3-cyanoanilino)-2-(3-fluoro-5-methylanilino)pyridine-3-carboxamide.
| Compound Name | 5-(3-cyanoanilino)-2-(3-fluoro-5-methylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 165177918 |
| Molecular Formula | C20H16FN5O |
| Molecular Weight | 361.38 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 5-(3-cyanoanilino)-2-(3-fluoro-5-methylanilino)pyridine-3-carboxamide |
| SMILES | Cc1cc(F)cc(Nc2ncc(Nc3cccc(C#N)c3)cc2C(N)=O)c1 |
| InChI | InChI=1S/C20H16FN5O/c1-12-5-14(21)8-16(6-12)26-20-18(19(23)27)9-17(11-24-20)25-15-4-2-3-13(7-15)10-22/h2-9,11,25H,1H3,(H2,23,27)(H,24,26) |
| InChIKey | NOTIKRUIEDATRX-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 103.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |