C16H20N2O5S — CID 165178177
ethyl 6-(1-ethoxyethenyl)-3-ethylsulfonylimidazo[1,2-a]pyridine-2-carboxylate (PubChem CID 165178177) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is ethyl 6-(1-ethoxyethenyl)-3-ethylsulfonylimidazo[1,2-a]pyridine-2-carboxylate.
| Compound Name | ethyl 6-(1-ethoxyethenyl)-3-ethylsulfonylimidazo[1,2-a]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 165178177 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | ethyl 6-(1-ethoxyethenyl)-3-ethylsulfonylimidazo[1,2-a]pyridine-2-carboxylate |
| SMILES | C=C(OCC)c1ccc2nc(C(=O)OCC)c(S(=O)(=O)CC)n2c1 |
| InChI | InChI=1S/C16H20N2O5S/c1-5-22-11(4)12-8-9-13-17-14(16(19)23-6-2)15(18(13)10-12)24(20,21)7-3/h8-10H,4-7H2,1-3H3 |
| InChIKey | RFHNOTCFPOGBFR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 86.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|