C13H15NO6 — CID 165178704
methyl 4-amino-7-[(3S)-oxolan-3-yl]oxy-1,3-benzodioxole-5-carboxylate (PubChem CID 165178704) has the molecular formula C13H15NO6 and a molecular weight of 281.26 g/mol. Its IUPAC name is methyl 4-amino-7-[(3S)-oxolan-3-yl]oxy-1,3-benzodioxole-5-carboxylate.
| Compound Name | methyl 4-amino-7-[(3S)-oxolan-3-yl]oxy-1,3-benzodioxole-5-carboxylate |
|---|---|
| PubChem CID | 165178704 |
| Molecular Formula | C13H15NO6 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | methyl 4-amino-7-[(3S)-oxolan-3-yl]oxy-1,3-benzodioxole-5-carboxylate |
| SMILES | COC(=O)c1cc(O[C@H]2CCOC2)c2c(c1N)OCO2 |
| InChI | InChI=1S/C13H15NO6/c1-16-13(15)8-4-9(20-7-2-3-17-5-7)11-12(10(8)14)19-6-18-11/h4,7H,2-3,5-6,14H2,1H3/t7-/m0/s1 |
| InChIKey | AVVOPRJCHGTFPK-ZETCQYMHSA-N |
| XLogP | 0.95 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|