C13H17N4O2+ — CID 165178713
2,7-dimethyl-6-morpholin-4-yl-3H-pyrido[3,4-d]pyrimidin-7-ium-4-one (PubChem CID 165178713) has the molecular formula C13H17N4O2+ and a molecular weight of 261.31 g/mol. Its IUPAC name is 2,7-dimethyl-6-morpholin-4-yl-3H-pyrido[3,4-d]pyrimidin-7-ium-4-one.
| Compound Name | 2,7-dimethyl-6-morpholin-4-yl-3H-pyrido[3,4-d]pyrimidin-7-ium-4-one |
|---|---|
| PubChem CID | 165178713 |
| Molecular Formula | C13H17N4O2+ |
| Molecular Weight | 261.31 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2,7-dimethyl-6-morpholin-4-yl-3H-pyrido[3,4-d]pyrimidin-7-ium-4-one |
| SMILES | Cc1nc2c[n+](C)c(N3CCOCC3)cc2c(=O)[nH]1 |
| InChI | InChI=1S/C13H16N4O2/c1-9-14-11-8-16(2)12(7-10(11)13(18)15-9)17-3-5-19-6-4-17/h7-8H,3-6H2,1-2H3/p+1 |
| InChIKey | NDOUTLYVBWUPKL-UHFFFAOYSA-O |
| XLogP | -0.11 |
| TPSA | 62.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.31 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|