C18H18FNOSe — CID 165179461
(3R,7aS)-6-fluoro-3-phenyl-6-phenylselanyl-3,5,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole (PubChem CID 165179461) has the molecular formula C18H18FNOSe and a molecular weight of 362.31 g/mol. Its IUPAC name is (3R,7aS)-6-fluoro-3-phenyl-6-phenylselanyl-3,5,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole.
| Compound Name | (3R,7aS)-6-fluoro-3-phenyl-6-phenylselanyl-3,5,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole |
|---|---|
| PubChem CID | 165179461 |
| Molecular Formula | C18H18FNOSe |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | (3R,7aS)-6-fluoro-3-phenyl-6-phenylselanyl-3,5,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazole |
| SMILES | FC1([Se]c2ccccc2)C[C@H]2CO[C@H](c3ccccc3)N2C1 |
| InChI | InChI=1S/C18H18FNOSe/c19-18(22-16-9-5-2-6-10-16)11-15-12-21-17(20(15)13-18)14-7-3-1-4-8-14/h1-10,15,17H,11-13H2/t15-,17+,18?/m0/s1 |
| InChIKey | UXDHQXIDQZBXLV-CTDRKSARSA-N |
| XLogP | 2.49 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|