C29H29N3O5 — CID 165179773
2-[6-(4-methoxyanilino)-2-(morpholine-4-carbonyl)indol-1-yl]-1-(4-methoxyphenyl)ethanone (PubChem CID 165179773) has the molecular formula C29H29N3O5 and a molecular weight of 499.57 g/mol. Its IUPAC name is 2-[6-(4-methoxyanilino)-2-(morpholine-4-carbonyl)indol-1-yl]-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-[6-(4-methoxyanilino)-2-(morpholine-4-carbonyl)indol-1-yl]-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 165179773 |
| Molecular Formula | C29H29N3O5 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | 2-[6-(4-methoxyanilino)-2-(morpholine-4-carbonyl)indol-1-yl]-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(Nc2ccc3cc(C(=O)N4CCOCC4)n(CC(=O)c4ccc(OC)cc4)c3c2)cc1 |
| InChI | InChI=1S/C29H29N3O5/c1-35-24-9-4-20(5-10-24)28(33)19-32-26-18-23(30-22-7-11-25(36-2)12-8-22)6-3-21(26)17-27(32)29(34)31-13-15-37-16-14-31/h3-12,17-18,30H,13-16,19H2,1-2H3 |
| InChIKey | AWMIKWWECHFYNZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 82.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |