C9H17NO5 — CID 165180114
(2R,3R,4R,5R,6S)-5-amino-2-(hydroxymethyl)-6-prop-2-enoxyoxane-3,4-diol (PubChem CID 165180114) has the molecular formula C9H17NO5 and a molecular weight of 219.24 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-5-amino-2-(hydroxymethyl)-6-prop-2-enoxyoxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6S)-5-amino-2-(hydroxymethyl)-6-prop-2-enoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 165180114 |
| Molecular Formula | C9H17NO5 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | (2R,3R,4R,5R,6S)-5-amino-2-(hydroxymethyl)-6-prop-2-enoxyoxane-3,4-diol |
| SMILES | C=CCO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1N |
| InChI | InChI=1S/C9H17NO5/c1-2-3-14-9-6(10)8(13)7(12)5(4-11)15-9/h2,5-9,11-13H,1,3-4,10H2/t5-,6-,7+,8-,9+/m1/s1 |
| InChIKey | HWMNNLGUQVZSHU-ZEBDFXRSSA-N |
| XLogP | -2.04 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|