C38H66O12S — CID 165183689
[1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoxy]propan-2-yl] heptanoate (PubChem CID 165183689) has the molecular formula C38H66O12S and a molecular weight of 747.00 g/mol. Its IUPAC name is [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoxy]propan-2-yl] heptanoate.
| Compound Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoxy]propan-2-yl] heptanoate |
|---|---|
| PubChem CID | 165183689 |
| Molecular Formula | C38H66O12S |
| Molecular Weight | 747.00 g/mol |
| Exact Mass | 746.43 |
| IUPAC Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoxy]propan-2-yl] heptanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCCOCC(COC1OC(CO)C(O)C(OS(=O)(=O)O)C1O)OC(=O)CCCCCC |
| InChI | InChI=1S/C38H66O12S/c1-3-5-7-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-26-28-46-30-32(48-34(40)27-25-8-6-4-2)31-47-38-36(42)37(50-51(43,44)45)35(41)33(29-39)49-38/h5,7,10-11,13-14,16-17,32-33,35-39,41-42H,3-4,6,8-9,12,15,18-31H2,1-2H3,(H,43,44,45)/b7-5-,11-10-,14-13-,17-16- |
| InChIKey | AMCABPMEWHVWEP-ZRENGBSJSA-N |
| XLogP | 6.45 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.00 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|