C27H50O12S — CID 165189238
[1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(Z)-hexadec-9-enoxy]propan-2-yl] acetate (PubChem CID 165189238) has the molecular formula C27H50O12S and a molecular weight of 598.75 g/mol. Its IUPAC name is [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(Z)-hexadec-9-enoxy]propan-2-yl] acetate.
| Compound Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(Z)-hexadec-9-enoxy]propan-2-yl] acetate |
|---|---|
| PubChem CID | 165189238 |
| Molecular Formula | C27H50O12S |
| Molecular Weight | 598.75 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(Z)-hexadec-9-enoxy]propan-2-yl] acetate |
| SMILES | CCCCCC/C=C\CCCCCCCCOCC(COC1OC(CO)C(O)C(OS(=O)(=O)O)C1O)OC(C)=O |
| InChI | InChI=1S/C27H50O12S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-35-19-22(37-21(2)29)20-36-27-25(31)26(39-40(32,33)34)24(30)23(18-28)38-27/h8-9,22-28,30-31H,3-7,10-20H2,1-2H3,(H,32,33,34)/b9-8- |
| InChIKey | BHUIRGUJJQLEDS-HJWRWDBZSA-N |
| XLogP | 2.84 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.75 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|