C33H56O12S — CID 165252823
[1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoxy]propan-2-yl] acetate (PubChem CID 165252823) has the molecular formula C33H56O12S and a molecular weight of 676.87 g/mol. Its IUPAC name is [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoxy]propan-2-yl] acetate.
| Compound Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoxy]propan-2-yl] acetate |
|---|---|
| PubChem CID | 165252823 |
| Molecular Formula | C33H56O12S |
| Molecular Weight | 676.87 g/mol |
| Exact Mass | 676.35 |
| IUPAC Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(10Z,13Z,16Z,19Z)-docosa-10,13,16,19-tetraenoxy]propan-2-yl] acetate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCCCOCC(COC1OC(CO)C(O)C(OS(=O)(=O)O)C1O)OC(C)=O |
| InChI | InChI=1S/C33H56O12S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-41-25-28(43-27(2)35)26-42-33-31(37)32(45-46(38,39)40)30(36)29(24-34)44-33/h4-5,7-8,10-11,13-14,28-34,36-37H,3,6,9,12,15-26H2,1-2H3,(H,38,39,40)/b5-4-,8-7-,11-10-,14-13- |
| InChIKey | MAWUPVQAWBKWBW-GJDCDIHCSA-N |
| XLogP | 4.50 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.87 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|