C21H17ClFNO5 — CID 16519015
[1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 5-(phenoxymethyl)furan-2-carboxylate (PubChem CID 16519015) has the molecular formula C21H17ClFNO5 and a molecular weight of 417.82 g/mol. Its IUPAC name is [1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 5-(phenoxymethyl)furan-2-carboxylate.
| Compound Name | [1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 5-(phenoxymethyl)furan-2-carboxylate |
|---|---|
| PubChem CID | 16519015 |
| Molecular Formula | C21H17ClFNO5 |
| Molecular Weight | 417.82 g/mol |
| Exact Mass | 417.08 |
| IUPAC Name | [1-(2-chloro-4-fluoroanilino)-1-oxopropan-2-yl] 5-(phenoxymethyl)furan-2-carboxylate |
| SMILES | CC(OC(=O)c1ccc(COc2ccccc2)o1)C(=O)Nc1ccc(F)cc1Cl |
| InChI | InChI=1S/C21H17ClFNO5/c1-13(20(25)24-18-9-7-14(23)11-17(18)22)28-21(26)19-10-8-16(29-19)12-27-15-5-3-2-4-6-15/h2-11,13H,12H2,1H3,(H,24,25) |
| InChIKey | HJMBAXIYLPQRMU-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.82 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |