C48H87O9P — CID 165195850
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(10Z,13Z,16Z)-tetracosa-10,13,16-trienoxy]propan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate (PubChem CID 165195850) has the molecular formula C48H87O9P and a molecular weight of 839.19 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(10Z,13Z,16Z)-tetracosa-10,13,16-trienoxy]propan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(10Z,13Z,16Z)-tetracosa-10,13,16-trienoxy]propan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate |
|---|---|
| PubChem CID | 165195850 |
| Molecular Formula | C48H87O9P |
| Molecular Weight | 839.19 g/mol |
| Exact Mass | 838.61 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(10Z,13Z,16Z)-tetracosa-10,13,16-trienoxy]propan-2-yl] (9Z,12Z)-octadeca-9,12-dienoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC(COCCCCCCCCC/C=C\C/C=C\C/C=C\CCCCCCC)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C48H87O9P/c1-3-5-7-9-11-13-15-17-19-20-21-22-23-24-25-27-29-31-33-35-37-39-41-54-44-47(45-56-58(52,53)55-43-46(50)42-49)57-48(51)40-38-36-34-32-30-28-26-18-16-14-12-10-8-6-4-2/h12,14-15,17-18,20-21,23-24,26,46-47,49-50H,3-11,13,16,19,22,25,27-45H2,1-2H3,(H,52,53)/b14-12-,17-15-,21-20-,24-23-,26-18- |
| InChIKey | CIMBGKQFTPWUAH-GWBNIQHTSA-N |
| XLogP | 13.15 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.19 |
| LogP ≤ 5 | 13.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|