C34H65O9P — CID 165263734
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-yl] decanoate (PubChem CID 165263734) has the molecular formula C34H65O9P and a molecular weight of 648.86 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-yl] decanoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-yl] decanoate |
|---|---|
| PubChem CID | 165263734 |
| Molecular Formula | C34H65O9P |
| Molecular Weight | 648.86 g/mol |
| Exact Mass | 648.44 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propan-2-yl] decanoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCOCC(COP(=O)(O)OCC(O)CO)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C34H65O9P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-21-23-25-27-40-30-33(31-42-44(38,39)41-29-32(36)28-35)43-34(37)26-24-22-20-10-8-6-4-2/h11-12,14-15,32-33,35-36H,3-10,13,16-31H2,1-2H3,(H,38,39)/b12-11-,15-14- |
| InChIKey | NSHLFMKZQYBTLQ-HDXUUTQWSA-N |
| XLogP | 8.36 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.86 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|