C35H69O9P — CID 165214370
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-nonadec-9-enoxy]propan-2-yl] decanoate (PubChem CID 165214370) has the molecular formula C35H69O9P and a molecular weight of 664.90 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-nonadec-9-enoxy]propan-2-yl] decanoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-nonadec-9-enoxy]propan-2-yl] decanoate |
|---|---|
| PubChem CID | 165214370 |
| Molecular Formula | C35H69O9P |
| Molecular Weight | 664.90 g/mol |
| Exact Mass | 664.47 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-nonadec-9-enoxy]propan-2-yl] decanoate |
| SMILES | CCCCCCCCC/C=C\CCCCCCCCOCC(COP(=O)(O)OCC(O)CO)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C35H69O9P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-26-28-41-31-34(32-43-45(39,40)42-30-33(37)29-36)44-35(38)27-25-23-21-10-8-6-4-2/h15-16,33-34,36-37H,3-14,17-32H2,1-2H3,(H,39,40)/b16-15- |
| InChIKey | GEDZOSNWIRUYIT-NXVVXOECSA-N |
| XLogP | 8.97 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.90 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|