C45H87O9P — CID 165225015
[1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-nonadec-9-enoxy]propan-2-yl] (Z)-icos-11-enoate (PubChem CID 165225015) has the molecular formula C45H87O9P and a molecular weight of 803.16 g/mol. Its IUPAC name is [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-nonadec-9-enoxy]propan-2-yl] (Z)-icos-11-enoate.
| Compound Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-nonadec-9-enoxy]propan-2-yl] (Z)-icos-11-enoate |
|---|---|
| PubChem CID | 165225015 |
| Molecular Formula | C45H87O9P |
| Molecular Weight | 803.16 g/mol |
| Exact Mass | 802.61 |
| IUPAC Name | [1-[2,3-dihydroxypropoxy(hydroxy)phosphoryl]oxy-3-[(Z)-nonadec-9-enoxy]propan-2-yl] (Z)-icos-11-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCCC(=O)OC(COCCCCCCCC/C=C\CCCCCCCCC)COP(=O)(O)OCC(O)CO |
| InChI | InChI=1S/C45H87O9P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-45(48)54-44(42-53-55(49,50)52-40-43(47)39-46)41-51-38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17,19-20,22,43-44,46-47H,3-16,18,21,23-42H2,1-2H3,(H,49,50)/b19-17-,22-20- |
| InChIKey | HUNLHMYBWWHAES-MGXYOJEMSA-N |
| XLogP | 12.65 |
| TPSA | 131.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 44 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.16 |
| LogP ≤ 5 | 12.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|