C49H84O12S — CID 165215762
[1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]propan-2-yl] (10Z,13Z,16Z)-tetracosa-10,13,16-trienoate (PubChem CID 165215762) has the molecular formula C49H84O12S and a molecular weight of 897.27 g/mol. Its IUPAC name is [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]propan-2-yl] (10Z,13Z,16Z)-tetracosa-10,13,16-trienoate.
| Compound Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]propan-2-yl] (10Z,13Z,16Z)-tetracosa-10,13,16-trienoate |
|---|---|
| PubChem CID | 165215762 |
| Molecular Formula | C49H84O12S |
| Molecular Weight | 897.27 g/mol |
| Exact Mass | 896.57 |
| IUPAC Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]propan-2-yl] (10Z,13Z,16Z)-tetracosa-10,13,16-trienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCOCC(COC1OC(CO)C(O)C(OS(=O)(=O)O)C1O)OC(=O)CCCCCCCC/C=C\C/C=C\C/C=C\CCCCCCC |
| InChI | InChI=1S/C49H84O12S/c1-3-5-7-9-11-13-15-17-19-20-21-22-23-24-25-26-28-30-32-34-36-38-45(51)59-43(41-57-39-37-35-33-31-29-27-18-16-14-12-10-8-6-4-2)42-58-49-47(53)48(61-62(54,55)56)46(52)44(40-50)60-49/h6,8,12,14-15,17-18,20-21,23-24,27,43-44,46-50,52-53H,3-5,7,9-11,13,16,19,22,25-26,28-42H2,1-2H3,(H,54,55,56)/b8-6-,14-12-,17-15-,21-20-,24-23-,27-18- |
| InChIKey | GJUZWEMSHRVRHN-CKKLMFCZSA-N |
| XLogP | 10.30 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 897.27 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|