C20H19N3O6S — CID 16521597
(5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate (PubChem CID 16521597) has the molecular formula C20H19N3O6S and a molecular weight of 429.45 g/mol. Its IUPAC name is (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16521597 |
| Molecular Formula | C20H19N3O6S |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | (5-phenyl-1,3,4-oxadiazol-2-yl)methyl 3-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(OCc1nnc(-c2ccccc2)o1)c1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H19N3O6S/c24-20(28-14-18-21-22-19(29-18)15-5-2-1-3-6-15)16-7-4-8-17(13-16)30(25,26)23-9-11-27-12-10-23/h1-8,13H,9-12,14H2 |
| InChIKey | LAJUDOJWFDIUJH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 111.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |