C37H69N2O7P — CID 165217998
2-aminoethyl [(4E,8E,12E)-3-hydroxy-2-[[(Z)-3-hydroxypentadec-9-enoyl]amino]icosa-4,8,12-trienyl] hydrogen phosphate (PubChem CID 165217998) has the molecular formula C37H69N2O7P and a molecular weight of 684.94 g/mol. Its IUPAC name is 2-aminoethyl [(4E,8E,12E)-3-hydroxy-2-[[(Z)-3-hydroxypentadec-9-enoyl]amino]icosa-4,8,12-trienyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(4E,8E,12E)-3-hydroxy-2-[[(Z)-3-hydroxypentadec-9-enoyl]amino]icosa-4,8,12-trienyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165217998 |
| Molecular Formula | C37H69N2O7P |
| Molecular Weight | 684.94 g/mol |
| Exact Mass | 684.48 |
| IUPAC Name | 2-aminoethyl [(4E,8E,12E)-3-hydroxy-2-[[(Z)-3-hydroxypentadec-9-enoyl]amino]icosa-4,8,12-trienyl] hydrogen phosphate |
| SMILES | CCCCC/C=C\CCCCCC(O)CC(=O)NC(COP(=O)(O)OCCN)C(O)/C=C/CC/C=C/CC/C=C/CCCCCCC |
| InChI | InChI=1S/C37H69N2O7P/c1-3-5-7-9-11-13-15-16-17-18-19-21-23-25-27-29-36(41)35(33-46-47(43,44)45-31-30-38)39-37(42)32-34(40)28-26-24-22-20-14-12-10-8-6-4-2/h12,14-16,19,21,27,29,34-36,40-41H,3-11,13,17-18,20,22-26,28,30-33,38H2,1-2H3,(H,39,42)(H,43,44)/b14-12-,16-15+,21-19+,29-27+ |
| InChIKey | GSQKEEAMYZYGDZ-QVSHLLCYSA-N |
| XLogP | 8.35 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.94 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|