C29H57N2O7P — CID 165277556
2-aminoethyl [(4E,8E)-3-hydroxy-2-(3-hydroxydodecanoylamino)pentadeca-4,8-dienyl] hydrogen phosphate (PubChem CID 165277556) has the molecular formula C29H57N2O7P and a molecular weight of 576.76 g/mol. Its IUPAC name is 2-aminoethyl [(4E,8E)-3-hydroxy-2-(3-hydroxydodecanoylamino)pentadeca-4,8-dienyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(4E,8E)-3-hydroxy-2-(3-hydroxydodecanoylamino)pentadeca-4,8-dienyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165277556 |
| Molecular Formula | C29H57N2O7P |
| Molecular Weight | 576.76 g/mol |
| Exact Mass | 576.39 |
| IUPAC Name | 2-aminoethyl [(4E,8E)-3-hydroxy-2-(3-hydroxydodecanoylamino)pentadeca-4,8-dienyl] hydrogen phosphate |
| SMILES | CCCCCC/C=C/CC/C=C/C(O)C(COP(=O)(O)OCCN)NC(=O)CC(O)CCCCCCCCC |
| InChI | InChI=1S/C29H57N2O7P/c1-3-5-7-9-11-12-13-15-17-19-21-28(33)27(25-38-39(35,36)37-23-22-30)31-29(34)24-26(32)20-18-16-14-10-8-6-4-2/h12-13,19,21,26-28,32-33H,3-11,14-18,20,22-25,30H2,1-2H3,(H,31,34)(H,35,36)/b13-12+,21-19+ |
| InChIKey | PVJDIWBDTLBSQS-NQCCGESRSA-N |
| XLogP | 5.68 |
| TPSA | 151.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.76 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|