C46H80O12S — CID 165227183
[1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]propan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate (PubChem CID 165227183) has the molecular formula C46H80O12S and a molecular weight of 857.20 g/mol. Its IUPAC name is [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]propan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate.
| Compound Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]propan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate |
|---|---|
| PubChem CID | 165227183 |
| Molecular Formula | C46H80O12S |
| Molecular Weight | 857.20 g/mol |
| Exact Mass | 856.54 |
| IUPAC Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]propan-2-yl] (11Z,14Z)-henicosa-11,14-dienoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCOCC(COC1OC(CO)C(O)C(OS(=O)(=O)O)C1O)OC(=O)CCCCCCCCC/C=C\C/C=C\CCCCCC |
| InChI | InChI=1S/C46H80O12S/c1-3-5-7-9-11-13-15-17-19-20-21-22-23-25-27-29-31-33-35-42(48)56-40(38-54-36-34-32-30-28-26-24-18-16-14-12-10-8-6-4-2)39-55-46-44(50)45(58-59(51,52)53)43(49)41(37-47)57-46/h6,8,12-15,18-20,24,40-41,43-47,49-50H,3-5,7,9-11,16-17,21-23,25-39H2,1-2H3,(H,51,52,53)/b8-6-,14-12-,15-13-,20-19-,24-18- |
| InChIKey | IDFBNWOGDSVUOL-MUDGPAQJSA-N |
| XLogP | 9.35 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 857.20 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|