C31H54O12S — CID 165229050
[1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]propan-2-yl] hexanoate (PubChem CID 165229050) has the molecular formula C31H54O12S and a molecular weight of 650.83 g/mol. Its IUPAC name is [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]propan-2-yl] hexanoate.
| Compound Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]propan-2-yl] hexanoate |
|---|---|
| PubChem CID | 165229050 |
| Molecular Formula | C31H54O12S |
| Molecular Weight | 650.83 g/mol |
| Exact Mass | 650.33 |
| IUPAC Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(7Z,10Z,13Z)-hexadeca-7,10,13-trienoxy]propan-2-yl] hexanoate |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCOCC(COC1OC(CO)C(O)C(OS(=O)(=O)O)C1O)OC(=O)CCCCC |
| InChI | InChI=1S/C31H54O12S/c1-3-5-7-8-9-10-11-12-13-14-15-16-17-19-21-39-23-25(41-27(33)20-18-6-4-2)24-40-31-29(35)30(43-44(36,37)38)28(34)26(22-32)42-31/h5,7,9-10,12-13,25-26,28-32,34-35H,3-4,6,8,11,14-24H2,1-2H3,(H,36,37,38)/b7-5-,10-9-,13-12- |
| InChIKey | IKPUTZLTMKERBT-XQOKXTRKSA-N |
| XLogP | 3.95 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.83 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|