About [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate
[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate (PubChem CID 16523289) has the molecular formula C20H13F5N2O3S
and a molecular weight of 456.39 g/mol. Its IUPAC name is [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate.
Molecular Properties
| Compound Name | [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate |
| PubChem CID | 16523289 |
| Molecular Formula | C20H13F5N2O3S |
| Molecular Weight | 456.39 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate |
| SMILES | CC(=O)N(c1cccc(C(F)(F)F)c1)c1nc(COC(=O)c2c(F)cccc2F)cs1 |
| InChI | InChI=1S/C20H13F5N2O3S/c1-11(28)27(14-5-2-4-12(8-14)20(23,24)25)19-26-13(10-31-19)9-30-18(29)17-15(21)6-3-7-16(17)22/h2-8,10H,9H2,1H3 |
| InChIKey | SNWRUHCKGWJZRF-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.39 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate?
The IUPAC name of [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate (CID 16523289) is [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate.
What is the SMILES notation for [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate?
The canonical SMILES for [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate is CC(=O)N(c1cccc(C(F)(F)F)c1)c1nc(COC(=O)c2c(F)cccc2F)cs1.
What is the InChIKey of [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate?
The InChIKey is SNWRUHCKGWJZRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13F5N2O3S/c1-11(28)27(14-5-2-4-12(8-14)20(23,24)25)19-26-13(10-31-19)9-30-18(29)17-15(21)6-3-7-16(17)22/h2-8,10H,9H2,1H3.
What are the key properties of [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate?
[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate has a molecular weight of 456.39 g/mol, XLogP of 5.48, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2,6-difluorobenzoate is sourced from PubChem (CID 16523289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).