C20H18F3N5O5S — CID 2530077
[2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate (PubChem CID 2530077) has the molecular formula C20H18F3N5O5S and a molecular weight of 497.46 g/mol. Its IUPAC name is [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate.
| Compound Name | [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 2530077 |
| Molecular Formula | C20H18F3N5O5S |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 497.10 |
| IUPAC Name | [2-[N-acetyl-3-(trifluoromethyl)anilino]-1,3-thiazol-4-yl]methyl 2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetate |
| SMILES | CC(=O)N(c1cccc(C(F)(F)F)c1)c1nc(COC(=O)Cn2nc(C)c([N+](=O)[O-])c2C)cs1 |
| InChI | InChI=1S/C20H18F3N5O5S/c1-11-18(28(31)32)12(2)26(25-11)8-17(30)33-9-15-10-34-19(24-15)27(13(3)29)16-6-4-5-14(7-16)20(21,22)23/h4-7,10H,8-9H2,1-3H3 |
| InChIKey | ITSBQCJZJJCXQG-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 120.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|