C45H74NO10P — CID 165236004
2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-3-[[3-[(Z)-heptadec-9-enoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 165236004) has the molecular formula C45H74NO10P and a molecular weight of 820.06 g/mol. Its IUPAC name is 2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-3-[[3-[(Z)-heptadec-9-enoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | 2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-3-[[3-[(Z)-heptadec-9-enoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 165236004 |
| Molecular Formula | C45H74NO10P |
| Molecular Weight | 820.06 g/mol |
| Exact Mass | 819.51 |
| IUPAC Name | 2-[[(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoyl]amino]-3-[[3-[(Z)-heptadec-9-enoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCC(=O)NC(COP(=O)(O)OCC(O)COC(=O)CCCCCCC/C=C\CCCCCCC)C(=O)O |
| InChI | InChI=1S/C45H74NO10P/c1-3-5-7-9-11-13-15-17-19-20-21-22-23-24-26-28-30-32-34-36-43(48)46-42(45(50)51)40-56-57(52,53)55-39-41(47)38-54-44(49)37-35-33-31-29-27-25-18-16-14-12-10-8-6-4-2/h5,7,11,13,16-19,21-22,24,26,30,32,41-42,47H,3-4,6,8-10,12,14-15,20,23,25,27-29,31,33-40H2,1-2H3,(H,46,48)(H,50,51)(H,52,53)/b7-5-,13-11-,18-16-,19-17-,22-21-,26-24-,32-30- |
| InChIKey | JMCRXXMJLIDJGL-IYGRLZAESA-N |
| XLogP | 10.72 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.06 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|