C53H90NO10P — CID 165274984
2-[[(Z)-henicos-11-enoyl]amino]-3-[[3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid (PubChem CID 165274984) has the molecular formula C53H90NO10P and a molecular weight of 932.27 g/mol. Its IUPAC name is 2-[[(Z)-henicos-11-enoyl]amino]-3-[[3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid.
| Compound Name | 2-[[(Z)-henicos-11-enoyl]amino]-3-[[3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 165274984 |
| Molecular Formula | C53H90NO10P |
| Molecular Weight | 932.27 g/mol |
| Exact Mass | 931.63 |
| IUPAC Name | 2-[[(Z)-henicos-11-enoyl]amino]-3-[[3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxypropanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)OCC(O)COP(=O)(O)OCC(NC(=O)CCCCCCCCC/C=C\CCCCCCCCC)C(=O)O |
| InChI | InChI=1S/C53H90NO10P/c1-3-5-7-9-11-13-15-17-19-21-23-24-25-26-27-29-31-33-35-37-39-41-43-45-52(57)62-46-49(55)47-63-65(60,61)64-48-50(53(58)59)54-51(56)44-42-40-38-36-34-32-30-28-22-20-18-16-14-12-10-8-6-4-2/h5,7,11,13,17,19-20,22-24,26-27,31,33,49-50,55H,3-4,6,8-10,12,14-16,18,21,25,28-30,32,34-48H2,1-2H3,(H,54,56)(H,58,59)(H,60,61)/b7-5-,13-11-,19-17-,22-20-,24-23-,27-26-,33-31- |
| InChIKey | PLEDIOKGKNCVEE-UAPVVSOYSA-N |
| XLogP | 13.84 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 932.27 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|