C44H78NO10P — CID 165306583
3-[hydroxy-[2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropoxy]phosphoryl]oxy-2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]propanoic acid (PubChem CID 165306583) has the molecular formula C44H78NO10P and a molecular weight of 812.08 g/mol. Its IUPAC name is 3-[hydroxy-[2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropoxy]phosphoryl]oxy-2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]propanoic acid.
| Compound Name | 3-[hydroxy-[2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropoxy]phosphoryl]oxy-2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 165306583 |
| Molecular Formula | C44H78NO10P |
| Molecular Weight | 812.08 g/mol |
| Exact Mass | 811.54 |
| IUPAC Name | 3-[hydroxy-[2-hydroxy-3-[(Z)-octadec-9-enoyl]oxypropoxy]phosphoryl]oxy-2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]propanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)NC(COP(=O)(O)OCC(O)COC(=O)CCCCCCC/C=C\CCCCCCCC)C(=O)O |
| InChI | InChI=1S/C44H78NO10P/c1-3-5-7-9-11-13-15-17-19-20-22-23-25-27-29-31-33-35-42(47)45-41(44(49)50)39-55-56(51,52)54-38-40(46)37-53-43(48)36-34-32-30-28-26-24-21-18-16-14-12-10-8-6-4-2/h5,7,11,13,17-19,21,40-41,46H,3-4,6,8-10,12,14-16,20,22-39H2,1-2H3,(H,45,47)(H,49,50)(H,51,52)/b7-5-,13-11-,19-17-,21-18- |
| InChIKey | UZMZECNXMJGPJG-ZYKQNZMBSA-N |
| XLogP | 11.00 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.08 |
| LogP ≤ 5 | 11.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|