C48H80NO10P — CID 165194502
3-[[3-[(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]propanoic acid (PubChem CID 165194502) has the molecular formula C48H80NO10P and a molecular weight of 862.14 g/mol. Its IUPAC name is 3-[[3-[(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]propanoic acid.
| Compound Name | 3-[[3-[(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 165194502 |
| Molecular Formula | C48H80NO10P |
| Molecular Weight | 862.14 g/mol |
| Exact Mass | 861.55 |
| IUPAC Name | 3-[[3-[(7Z,10Z,13Z,16Z)-docosa-7,10,13,16-tetraenoyl]oxy-2-hydroxypropoxy]-hydroxyphosphoryl]oxy-2-[[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]amino]propanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)NC(COP(=O)(O)OCC(O)COC(=O)CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCCC)C(=O)O |
| InChI | InChI=1S/C48H80NO10P/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-36-38-40-47(52)57-41-44(50)42-58-60(55,56)59-43-45(48(53)54)49-46(51)39-37-35-33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h6,8,11-14,17-20,22,24,28,30,44-45,50H,3-5,7,9-10,15-16,21,23,25-27,29,31-43H2,1-2H3,(H,49,51)(H,53,54)(H,55,56)/b8-6-,13-11-,14-12-,19-17-,20-18-,24-22-,30-28- |
| InChIKey | CDEAJJWEYPFIKJ-QNSDGJDGSA-N |
| XLogP | 11.89 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 862.14 |
| LogP ≤ 5 | 11.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|