C33H58NO10P — CID 165312602
3-[hydroxy-(2-hydroxy-3-nonanoyloxypropoxy)phosphoryl]oxy-2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]amino]propanoic acid (PubChem CID 165312602) has the molecular formula C33H58NO10P and a molecular weight of 659.80 g/mol. Its IUPAC name is 3-[hydroxy-(2-hydroxy-3-nonanoyloxypropoxy)phosphoryl]oxy-2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]amino]propanoic acid.
| Compound Name | 3-[hydroxy-(2-hydroxy-3-nonanoyloxypropoxy)phosphoryl]oxy-2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 165312602 |
| Molecular Formula | C33H58NO10P |
| Molecular Weight | 659.80 g/mol |
| Exact Mass | 659.38 |
| IUPAC Name | 3-[hydroxy-(2-hydroxy-3-nonanoyloxypropoxy)phosphoryl]oxy-2-[[(9Z,12Z,15Z)-octadeca-9,12,15-trienoyl]amino]propanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)NC(COP(=O)(O)OCC(O)COC(=O)CCCCCCCC)C(=O)O |
| InChI | InChI=1S/C33H58NO10P/c1-3-5-7-9-11-12-13-14-15-16-17-18-19-20-22-24-31(36)34-30(33(38)39)28-44-45(40,41)43-27-29(35)26-42-32(37)25-23-21-10-8-6-4-2/h5,7,11-12,14-15,29-30,35H,3-4,6,8-10,13,16-28H2,1-2H3,(H,34,36)(H,38,39)(H,40,41)/b7-5-,12-11-,15-14- |
| InChIKey | VXQQIXOZWFKVFK-BBDKIWCZSA-N |
| XLogP | 6.93 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.80 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|