C45H78O12S — CID 165238868
[1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(Z)-octadec-9-enoxy]propan-2-yl] (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate (PubChem CID 165238868) has the molecular formula C45H78O12S and a molecular weight of 843.17 g/mol. Its IUPAC name is [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(Z)-octadec-9-enoxy]propan-2-yl] (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate.
| Compound Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(Z)-octadec-9-enoxy]propan-2-yl] (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate |
|---|---|
| PubChem CID | 165238868 |
| Molecular Formula | C45H78O12S |
| Molecular Weight | 843.17 g/mol |
| Exact Mass | 842.52 |
| IUPAC Name | [1-[3,5-dihydroxy-6-(hydroxymethyl)-4-sulfooxyoxan-2-yl]oxy-3-[(Z)-octadec-9-enoxy]propan-2-yl] (6Z,9Z,12Z,15Z)-octadeca-6,9,12,15-tetraenoate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCC(=O)OC(COCCCCCCCC/C=C\CCCCCCCC)COC1OC(CO)C(O)C(OS(=O)(=O)O)C1O |
| InChI | InChI=1S/C45H78O12S/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-53-37-39(38-54-45-43(49)44(57-58(50,51)52)42(48)40(36-46)56-45)55-41(47)34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h6,8,12,14,17-20,24,26,39-40,42-46,48-49H,3-5,7,9-11,13,15-16,21-23,25,27-38H2,1-2H3,(H,50,51,52)/b8-6-,14-12-,19-17-,20-18-,26-24- |
| InChIKey | JXEKCLIBBSVVNF-QWBVDZTBSA-N |
| XLogP | 8.96 |
| TPSA | 178.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 843.17 |
| LogP ≤ 5 | 8.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|