C41H75N2O6P — CID 165241037
2-aminoethyl [(4E,8E,12E)-2-[[(11Z,14Z)-henicosa-11,14-dienoyl]amino]-3-hydroxyoctadeca-4,8,12-trienyl] hydrogen phosphate (PubChem CID 165241037) has the molecular formula C41H75N2O6P and a molecular weight of 723.03 g/mol. Its IUPAC name is 2-aminoethyl [(4E,8E,12E)-2-[[(11Z,14Z)-henicosa-11,14-dienoyl]amino]-3-hydroxyoctadeca-4,8,12-trienyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(4E,8E,12E)-2-[[(11Z,14Z)-henicosa-11,14-dienoyl]amino]-3-hydroxyoctadeca-4,8,12-trienyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165241037 |
| Molecular Formula | C41H75N2O6P |
| Molecular Weight | 723.03 g/mol |
| Exact Mass | 722.54 |
| IUPAC Name | 2-aminoethyl [(4E,8E,12E)-2-[[(11Z,14Z)-henicosa-11,14-dienoyl]amino]-3-hydroxyoctadeca-4,8,12-trienyl] hydrogen phosphate |
| SMILES | CCCCC/C=C/CC/C=C/CC/C=C/C(O)C(COP(=O)(O)OCCN)NC(=O)CCCCCCCCC/C=C\C/C=C\CCCCCC |
| InChI | InChI=1S/C41H75N2O6P/c1-3-5-7-9-11-13-15-17-18-19-20-21-23-25-27-29-31-33-35-41(45)43-39(38-49-50(46,47)48-37-36-42)40(44)34-32-30-28-26-24-22-16-14-12-10-8-6-4-2/h12-15,18-19,24,26,32,34,39-40,44H,3-11,16-17,20-23,25,27-31,33,35-38,42H2,1-2H3,(H,43,45)(H,46,47)/b14-12+,15-13-,19-18-,26-24+,34-32+ |
| InChIKey | KFWKQLLPZYSQJC-LYAVJNOVSA-N |
| XLogP | 10.72 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.03 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|