C39H73N2O6P — CID 165317726
2-aminoethyl [(4E,8E)-3-hydroxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]nonadeca-4,8-dienyl] hydrogen phosphate (PubChem CID 165317726) has the molecular formula C39H73N2O6P and a molecular weight of 697.00 g/mol. Its IUPAC name is 2-aminoethyl [(4E,8E)-3-hydroxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]nonadeca-4,8-dienyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(4E,8E)-3-hydroxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]nonadeca-4,8-dienyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165317726 |
| Molecular Formula | C39H73N2O6P |
| Molecular Weight | 697.00 g/mol |
| Exact Mass | 696.52 |
| IUPAC Name | 2-aminoethyl [(4E,8E)-3-hydroxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]nonadeca-4,8-dienyl] hydrogen phosphate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)NC(COP(=O)(O)OCCN)C(O)/C=C/CC/C=C/CCCCCCCCCC |
| InChI | InChI=1S/C39H73N2O6P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-39(43)41-37(36-47-48(44,45)46-35-34-40)38(42)32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h11,13,17,19,22,24,30,32,37-38,42H,3-10,12,14-16,18,20-21,23,25-29,31,33-36,40H2,1-2H3,(H,41,43)(H,44,45)/b13-11-,19-17-,24-22+,32-30+ |
| InChIKey | WSDHPVDCVULIID-ZNSAMFESSA-N |
| XLogP | 10.16 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.00 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|