C36H62NO7P — CID 165245895
[2-acetyloxy-3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 165245895) has the molecular formula C36H62NO7P and a molecular weight of 651.87 g/mol. Its IUPAC name is [2-acetyloxy-3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-acetyloxy-3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 165245895 |
| Molecular Formula | C36H62NO7P |
| Molecular Weight | 651.87 g/mol |
| Exact Mass | 651.43 |
| IUPAC Name | [2-acetyloxy-3-[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(C)=O |
| InChI | InChI=1S/C36H62NO7P/c1-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-31-41-33-36(44-35(2)38)34-43-45(39,40)42-32-30-37(3,4)5/h7-8,10-11,13-14,16-17,19-20,22-23,36H,6,9,12,15,18,21,24-34H2,1-5H3/b8-7-,11-10-,14-13-,17-16-,20-19-,23-22- |
| InChIKey | KZFUFIWZBHMKGN-XTJKPUCJSA-N |
| XLogP | 8.18 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.87 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|