C31H56NO7P — CID 138278104
[3-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoxy]-2-propanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138278104) has the molecular formula C31H56NO7P and a molecular weight of 585.76 g/mol. Its IUPAC name is [3-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoxy]-2-propanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoxy]-2-propanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138278104 |
| Molecular Formula | C31H56NO7P |
| Molecular Weight | 585.76 g/mol |
| Exact Mass | 585.38 |
| IUPAC Name | [3-[(8Z,11Z,14Z,17Z)-icosa-8,11,14,17-tetraenoxy]-2-propanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\CCCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CC |
| InChI | InChI=1S/C31H56NO7P/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-26-36-28-30(39-31(33)7-2)29-38-40(34,35)37-27-25-32(3,4)5/h8-9,11-12,14-15,17-18,30H,6-7,10,13,16,19-29H2,1-5H3/b9-8-,12-11-,15-14-,18-17- |
| InChIKey | VDCKUDOLWSQTTD-GKFVBPDJSA-N |
| XLogP | 6.68 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.76 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|