C28H54NO7P — CID 165315171
[3-[(9Z,12Z)-heptadeca-9,12-dienoxy]-2-propanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 165315171) has the molecular formula C28H54NO7P and a molecular weight of 547.71 g/mol. Its IUPAC name is [3-[(9Z,12Z)-heptadeca-9,12-dienoxy]-2-propanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-[(9Z,12Z)-heptadeca-9,12-dienoxy]-2-propanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 165315171 |
| Molecular Formula | C28H54NO7P |
| Molecular Weight | 547.71 g/mol |
| Exact Mass | 547.36 |
| IUPAC Name | [3-[(9Z,12Z)-heptadeca-9,12-dienoxy]-2-propanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CC |
| InChI | InChI=1S/C28H54NO7P/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-23-33-25-27(36-28(30)7-2)26-35-37(31,32)34-24-22-29(3,4)5/h10-11,13-14,27H,6-9,12,15-26H2,1-5H3/b11-10-,14-13- |
| InChIKey | WHVVFVUXZMVUFK-XVTLYKPTSA-N |
| XLogP | 5.96 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.71 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|