C43H82NO7P — CID 165291640
[3-[(11Z,14Z)-henicosa-11,14-dienoxy]-2-[(Z)-tetradec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 165291640) has the molecular formula C43H82NO7P and a molecular weight of 756.10 g/mol. Its IUPAC name is [3-[(11Z,14Z)-henicosa-11,14-dienoxy]-2-[(Z)-tetradec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-[(11Z,14Z)-henicosa-11,14-dienoxy]-2-[(Z)-tetradec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 165291640 |
| Molecular Formula | C43H82NO7P |
| Molecular Weight | 756.10 g/mol |
| Exact Mass | 755.58 |
| IUPAC Name | [3-[(11Z,14Z)-henicosa-11,14-dienoxy]-2-[(Z)-tetradec-9-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCC/C=C\CCCCCCCC(=O)OC(COCCCCCCCCCC/C=C\C/C=C\CCCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C43H82NO7P/c1-6-8-10-12-14-16-18-19-20-21-22-23-24-25-27-29-31-33-35-38-48-40-42(41-50-52(46,47)49-39-37-44(3,4)5)51-43(45)36-34-32-30-28-26-17-15-13-11-9-7-2/h13,15-16,18,20-21,42H,6-12,14,17,19,22-41H2,1-5H3/b15-13-,18-16-,21-20- |
| InChIKey | RYPCCSWTJVAUPO-SKYXVPILSA-N |
| XLogP | 11.58 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.10 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|