C45H86NO7P — CID 165325411
[3-[(9Z,12Z)-heptadeca-9,12-dienoxy]-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 165325411) has the molecular formula C45H86NO7P and a molecular weight of 784.16 g/mol. Its IUPAC name is [3-[(9Z,12Z)-heptadeca-9,12-dienoxy]-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-[(9Z,12Z)-heptadeca-9,12-dienoxy]-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 165325411 |
| Molecular Formula | C45H86NO7P |
| Molecular Weight | 784.16 g/mol |
| Exact Mass | 783.61 |
| IUPAC Name | [3-[(9Z,12Z)-heptadeca-9,12-dienoxy]-2-[(Z)-icos-11-enoyl]oxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCC/C=C\C/C=C\CCCCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C45H86NO7P/c1-6-8-10-12-14-16-18-20-22-23-24-26-28-30-32-34-36-38-45(47)53-44(43-52-54(48,49)51-41-39-46(3,4)5)42-50-40-37-35-33-31-29-27-25-21-19-17-15-13-11-9-7-2/h13,15,19-22,44H,6-12,14,16-18,23-43H2,1-5H3/b15-13-,21-19-,22-20- |
| InChIKey | XWYTWJBNLXWEGR-YVFFZHSKSA-N |
| XLogP | 12.36 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.16 |
| LogP ≤ 5 | 12.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|