C53H98NO7P — CID 165250277
[2-[(11Z,14Z)-henicosa-11,14-dienoyl]oxy-3-[(10Z,13Z,16Z)-tetracosa-10,13,16-trienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 165250277) has the molecular formula C53H98NO7P and a molecular weight of 892.34 g/mol. Its IUPAC name is [2-[(11Z,14Z)-henicosa-11,14-dienoyl]oxy-3-[(10Z,13Z,16Z)-tetracosa-10,13,16-trienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-[(11Z,14Z)-henicosa-11,14-dienoyl]oxy-3-[(10Z,13Z,16Z)-tetracosa-10,13,16-trienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 165250277 |
| Molecular Formula | C53H98NO7P |
| Molecular Weight | 892.34 g/mol |
| Exact Mass | 891.71 |
| IUPAC Name | [2-[(11Z,14Z)-henicosa-11,14-dienoyl]oxy-3-[(10Z,13Z,16Z)-tetracosa-10,13,16-trienoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCCCC/C=C\C/C=C\CCCCCCCCCC(=O)OC(COCCCCCCCCC/C=C\C/C=C\C/C=C\CCCCCCC)COP(=O)([O-])OCC[N+](C)(C)C |
| InChI | InChI=1S/C53H98NO7P/c1-6-8-10-12-14-16-18-20-22-24-26-27-28-29-31-33-35-37-39-41-43-45-48-58-50-52(51-60-62(56,57)59-49-47-54(3,4)5)61-53(55)46-44-42-40-38-36-34-32-30-25-23-21-19-17-15-13-11-9-7-2/h17-20,23-26,28-29,52H,6-16,21-22,27,30-51H2,1-5H3/b19-17-,20-18-,25-23-,26-24-,29-28- |
| InChIKey | LQQJOJIULZVPKN-SZUPLFEYSA-N |
| XLogP | 15.04 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 892.34 |
| LogP ≤ 5 | 15.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|