C41H78NO7P — CID 138119599
[2-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxy-3-[(Z)-tetradec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138119599) has the molecular formula C41H78NO7P and a molecular weight of 728.05 g/mol. Its IUPAC name is [2-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxy-3-[(Z)-tetradec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [2-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxy-3-[(Z)-tetradec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138119599 |
| Molecular Formula | C41H78NO7P |
| Molecular Weight | 728.05 g/mol |
| Exact Mass | 727.55 |
| IUPAC Name | [2-[(9Z,12Z)-nonadeca-9,12-dienoyl]oxy-3-[(Z)-tetradec-9-enoxy]propyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CCCC/C=C\CCCCCCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CCCCCCC/C=C\C/C=C\CCCCCC |
| InChI | InChI=1S/C41H78NO7P/c1-6-8-10-12-14-16-18-20-21-22-23-24-26-28-30-32-34-41(43)49-40(39-48-50(44,45)47-37-35-42(3,4)5)38-46-36-33-31-29-27-25-19-17-15-13-11-9-7-2/h13,15-16,18,21-22,40H,6-12,14,17,19-20,23-39H2,1-5H3/b15-13-,18-16-,22-21- |
| InChIKey | ALUZOFCQBYVXAR-NLIWCXCPSA-N |
| XLogP | 10.80 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.05 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|