C31H54NO7P — CID 138136804
[3-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]-2-propanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate (PubChem CID 138136804) has the molecular formula C31H54NO7P and a molecular weight of 583.75 g/mol. Its IUPAC name is [3-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]-2-propanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate.
| Compound Name | [3-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]-2-propanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| PubChem CID | 138136804 |
| Molecular Formula | C31H54NO7P |
| Molecular Weight | 583.75 g/mol |
| Exact Mass | 583.36 |
| IUPAC Name | [3-[(5Z,8Z,11Z,14Z,17Z)-icosa-5,8,11,14,17-pentaenoxy]-2-propanoyloxypropyl] 2-(trimethylazaniumyl)ethyl phosphate |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCOCC(COP(=O)([O-])OCC[N+](C)(C)C)OC(=O)CC |
| InChI | InChI=1S/C31H54NO7P/c1-6-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-26-36-28-30(39-31(33)7-2)29-38-40(34,35)37-27-25-32(3,4)5/h8-9,11-12,14-15,17-18,20-21,30H,6-7,10,13,16,19,22-29H2,1-5H3/b9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | CNGXCOXMGQPPKT-QXPWYRSVSA-N |
| XLogP | 6.45 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.75 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|