C45H85NO7P+ — CID 165246096
2-[[3-[(11Z,14Z)-henicosa-11,14-dienoxy]-2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 165246096) has the molecular formula C45H85NO7P+ and a molecular weight of 783.15 g/mol. Its IUPAC name is 2-[[3-[(11Z,14Z)-henicosa-11,14-dienoxy]-2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[3-[(11Z,14Z)-henicosa-11,14-dienoxy]-2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 165246096 |
| Molecular Formula | C45H85NO7P+ |
| Molecular Weight | 783.15 g/mol |
| Exact Mass | 782.61 |
| IUPAC Name | 2-[[3-[(11Z,14Z)-henicosa-11,14-dienoxy]-2-[(9Z,12Z)-hexadeca-9,12-dienoyl]oxypropoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCC/C=C\C/C=C\CCCCCCCC(=O)OC(COCCCCCCCCCC/C=C\C/C=C\CCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C45H84NO7P/c1-6-8-10-12-14-16-18-20-21-22-23-24-25-27-29-31-33-35-37-40-50-42-44(43-52-54(48,49)51-41-39-46(3,4)5)53-45(47)38-36-34-32-30-28-26-19-17-15-13-11-9-7-2/h11,13,16-19,21-22,44H,6-10,12,14-15,20,23-43H2,1-5H3/p+1/b13-11-,18-16-,19-17-,22-21- |
| InChIKey | LAAFDMSGPMLIOG-UCHXSRIUSA-O |
| XLogP | 12.77 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 783.15 |
| LogP ≤ 5 | 12.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|