C34H67NO7P+ — CID 138214641
2-[[2-decanoyloxy-3-[(9Z,12Z)-hexadeca-9,12-dienoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 138214641) has the molecular formula C34H67NO7P+ and a molecular weight of 632.88 g/mol. Its IUPAC name is 2-[[2-decanoyloxy-3-[(9Z,12Z)-hexadeca-9,12-dienoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[2-decanoyloxy-3-[(9Z,12Z)-hexadeca-9,12-dienoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 138214641 |
| Molecular Formula | C34H67NO7P+ |
| Molecular Weight | 632.88 g/mol |
| Exact Mass | 632.46 |
| IUPAC Name | 2-[[2-decanoyloxy-3-[(9Z,12Z)-hexadeca-9,12-dienoxy]propoxy]-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCC/C=C\C/C=C\CCCCCCCCOCC(COP(=O)(O)OCC[N+](C)(C)C)OC(=O)CCCCCCCCC |
| InChI | InChI=1S/C34H66NO7P/c1-6-8-10-12-14-15-16-17-18-19-20-22-24-26-29-39-31-33(32-41-43(37,38)40-30-28-35(3,4)5)42-34(36)27-25-23-21-13-11-9-7-2/h10,12,15-16,33H,6-9,11,13-14,17-32H2,1-5H3/p+1/b12-10-,16-15- |
| InChIKey | MULFXTQFAWCZGD-LYZHNOTLSA-O |
| XLogP | 8.93 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.88 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|