C42H81NO7P+ — CID 165312696
2-[hydroxy-[3-[(9Z,12Z)-nonadeca-9,12-dienoxy]-2-[(Z)-pentadec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium (PubChem CID 165312696) has the molecular formula C42H81NO7P+ and a molecular weight of 743.08 g/mol. Its IUPAC name is 2-[hydroxy-[3-[(9Z,12Z)-nonadeca-9,12-dienoxy]-2-[(Z)-pentadec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[hydroxy-[3-[(9Z,12Z)-nonadeca-9,12-dienoxy]-2-[(Z)-pentadec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 165312696 |
| Molecular Formula | C42H81NO7P+ |
| Molecular Weight | 743.08 g/mol |
| Exact Mass | 742.57 |
| IUPAC Name | 2-[hydroxy-[3-[(9Z,12Z)-nonadeca-9,12-dienoxy]-2-[(Z)-pentadec-9-enoyl]oxypropoxy]phosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCC/C=C\CCCCCCCC(=O)OC(COCCCCCCCC/C=C\C/C=C\CCCCCC)COP(=O)(O)OCC[N+](C)(C)C |
| InChI | InChI=1S/C42H80NO7P/c1-6-8-10-12-14-16-18-20-21-22-23-24-26-28-30-32-34-37-47-39-41(40-49-51(45,46)48-38-36-43(3,4)5)50-42(44)35-33-31-29-27-25-19-17-15-13-11-9-7-2/h15-18,21-22,41H,6-14,19-20,23-40H2,1-5H3/p+1/b17-15-,18-16-,22-21- |
| InChIKey | VYAJOMUXPXWPTC-HWDNNTMPSA-O |
| XLogP | 11.83 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.08 |
| LogP ≤ 5 | 11.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|