C36H58NO10P — CID 165250875
3-[(3-butanoyloxy-2-hydroxypropoxy)-hydroxyphosphoryl]oxy-2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]propanoic acid (PubChem CID 165250875) has the molecular formula C36H58NO10P and a molecular weight of 695.83 g/mol. Its IUPAC name is 3-[(3-butanoyloxy-2-hydroxypropoxy)-hydroxyphosphoryl]oxy-2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]propanoic acid.
| Compound Name | 3-[(3-butanoyloxy-2-hydroxypropoxy)-hydroxyphosphoryl]oxy-2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 165250875 |
| Molecular Formula | C36H58NO10P |
| Molecular Weight | 695.83 g/mol |
| Exact Mass | 695.38 |
| IUPAC Name | 3-[(3-butanoyloxy-2-hydroxypropoxy)-hydroxyphosphoryl]oxy-2-[[(8Z,11Z,14Z,17Z,20Z,23Z)-hexacosa-8,11,14,17,20,23-hexaenoyl]amino]propanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\C/C=C\C/C=C\C/C=C\CCCCCCC(=O)NC(COP(=O)(O)OCC(O)COC(=O)CCC)C(=O)O |
| InChI | InChI=1S/C36H58NO10P/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-28-34(39)37-33(36(41)42)31-47-48(43,44)46-30-32(38)29-45-35(40)27-4-2/h5-6,8-9,11-12,14-15,17-18,20-21,32-33,38H,3-4,7,10,13,16,19,22-31H2,1-2H3,(H,37,39)(H,41,42)(H,43,44)/b6-5-,9-8-,12-11-,15-14-,18-17-,21-20- |
| InChIKey | LSXJXIZWKHSOLG-YNUSHXQLSA-N |
| XLogP | 7.43 |
| TPSA | 168.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.83 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|