C44H78NO9P — CID 165251267
2-amino-3-[hydroxy-[2-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propoxy]phosphoryl]oxypropanoic acid (PubChem CID 165251267) has the molecular formula C44H78NO9P and a molecular weight of 796.08 g/mol. Its IUPAC name is 2-amino-3-[hydroxy-[2-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propoxy]phosphoryl]oxypropanoic acid.
| Compound Name | 2-amino-3-[hydroxy-[2-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propoxy]phosphoryl]oxypropanoic acid |
|---|---|
| PubChem CID | 165251267 |
| Molecular Formula | C44H78NO9P |
| Molecular Weight | 796.08 g/mol |
| Exact Mass | 795.54 |
| IUPAC Name | 2-amino-3-[hydroxy-[2-[(11Z,14Z,17Z)-icosa-11,14,17-trienoyl]oxy-3-[(9Z,12Z)-octadeca-9,12-dienoxy]propoxy]phosphoryl]oxypropanoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCCCC(=O)OC(COCCCCCCCC/C=C\C/C=C\CCCCC)COP(=O)(O)OCC(N)C(=O)O |
| InChI | InChI=1S/C44H78NO9P/c1-3-5-7-9-11-13-15-17-19-21-22-24-26-28-30-32-34-36-43(46)54-41(39-52-55(49,50)53-40-42(45)44(47)48)38-51-37-35-33-31-29-27-25-23-20-18-16-14-12-10-8-6-4-2/h5,7,11-14,17-20,41-42H,3-4,6,8-10,15-16,21-40,45H2,1-2H3,(H,47,48)(H,49,50)/b7-5-,13-11-,14-12-,19-17-,20-18- |
| InChIKey | LUNBPLDBJIQEEL-LOYOHVQTSA-N |
| XLogP | 11.64 |
| TPSA | 154.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 796.08 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|