C33H63N2O6P — CID 165254186
2-aminoethyl [(4E,8E)-2-[[(Z)-heptadec-9-enoyl]amino]-3-hydroxytetradeca-4,8-dienyl] hydrogen phosphate (PubChem CID 165254186) has the molecular formula C33H63N2O6P and a molecular weight of 614.85 g/mol. Its IUPAC name is 2-aminoethyl [(4E,8E)-2-[[(Z)-heptadec-9-enoyl]amino]-3-hydroxytetradeca-4,8-dienyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [(4E,8E)-2-[[(Z)-heptadec-9-enoyl]amino]-3-hydroxytetradeca-4,8-dienyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165254186 |
| Molecular Formula | C33H63N2O6P |
| Molecular Weight | 614.85 g/mol |
| Exact Mass | 614.44 |
| IUPAC Name | 2-aminoethyl [(4E,8E)-2-[[(Z)-heptadec-9-enoyl]amino]-3-hydroxytetradeca-4,8-dienyl] hydrogen phosphate |
| SMILES | CCCCC/C=C/CC/C=C/C(O)C(COP(=O)(O)OCCN)NC(=O)CCCCCCC/C=C\CCCCCCC |
| InChI | InChI=1S/C33H63N2O6P/c1-3-5-7-9-11-13-14-15-16-17-19-21-23-25-27-33(37)35-31(30-41-42(38,39)40-29-28-34)32(36)26-24-22-20-18-12-10-8-6-4-2/h12,14-15,18,24,26,31-32,36H,3-11,13,16-17,19-23,25,27-30,34H2,1-2H3,(H,35,37)(H,38,39)/b15-14-,18-12+,26-24+ |
| InChIKey | MGDWBYUYNDWPHV-RRLWTUIPSA-N |
| XLogP | 8.04 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.85 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|