C35H69N2O6P — CID 165255394
2-aminoethyl [3-hydroxy-2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]tridecyl] hydrogen phosphate (PubChem CID 165255394) has the molecular formula C35H69N2O6P and a molecular weight of 644.92 g/mol. Its IUPAC name is 2-aminoethyl [3-hydroxy-2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]tridecyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [3-hydroxy-2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]tridecyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165255394 |
| Molecular Formula | C35H69N2O6P |
| Molecular Weight | 644.92 g/mol |
| Exact Mass | 644.49 |
| IUPAC Name | 2-aminoethyl [3-hydroxy-2-[[(11Z,14Z)-icosa-11,14-dienoyl]amino]tridecyl] hydrogen phosphate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCCC(=O)NC(COP(=O)(O)OCCN)C(O)CCCCCCCCCC |
| InChI | InChI=1S/C35H69N2O6P/c1-3-5-7-9-11-13-14-15-16-17-18-19-20-21-23-25-27-29-35(39)37-33(32-43-44(40,41)42-31-30-36)34(38)28-26-24-22-12-10-8-6-4-2/h11,13,15-16,33-34,38H,3-10,12,14,17-32,36H2,1-2H3,(H,37,39)(H,40,41)/b13-11-,16-15- |
| InChIKey | MKWRJGUYVZAUNM-DURLKXOLSA-N |
| XLogP | 9.05 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.92 |
| LogP ≤ 5 | 9.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|