C33H65N2O6P — CID 165259347
2-aminoethyl [3-hydroxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]tridecyl] hydrogen phosphate (PubChem CID 165259347) has the molecular formula C33H65N2O6P and a molecular weight of 616.87 g/mol. Its IUPAC name is 2-aminoethyl [3-hydroxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]tridecyl] hydrogen phosphate.
| Compound Name | 2-aminoethyl [3-hydroxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]tridecyl] hydrogen phosphate |
|---|---|
| PubChem CID | 165259347 |
| Molecular Formula | C33H65N2O6P |
| Molecular Weight | 616.87 g/mol |
| Exact Mass | 616.46 |
| IUPAC Name | 2-aminoethyl [3-hydroxy-2-[[(9Z,12Z)-octadeca-9,12-dienoyl]amino]tridecyl] hydrogen phosphate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)NC(COP(=O)(O)OCCN)C(O)CCCCCCCCCC |
| InChI | InChI=1S/C33H65N2O6P/c1-3-5-7-9-11-13-14-15-16-17-18-19-21-23-25-27-33(37)35-31(30-41-42(38,39)40-29-28-34)32(36)26-24-22-20-12-10-8-6-4-2/h11,13,15-16,31-32,36H,3-10,12,14,17-30,34H2,1-2H3,(H,35,37)(H,38,39)/b13-11-,16-15- |
| InChIKey | NAVBSDAXVXQKBP-DURLKXOLSA-N |
| XLogP | 8.27 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.87 |
| LogP ≤ 5 | 8.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|